About N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide
N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide (PubChem CID 70139502) has the molecular formula C6H6N2O3
and a molecular weight of 154.12 g/mol. Its IUPAC name is N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide.
Molecular Properties
| Compound Name | N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide |
| PubChem CID | 70139502 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide |
| SMILES | O=C1C=CC=CC1N[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O3/c9-6-4-2-1-3-5(6)7-8(10)11/h1-5,7H |
| InChIKey | YLDIZMMBGZCMSC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide?
The IUPAC name of N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide (CID 70139502) is N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide.
What is the SMILES notation for N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide?
The canonical SMILES for N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide is O=C1C=CC=CC1N[N+](=O)[O-].
What is the InChIKey of N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide?
The InChIKey is YLDIZMMBGZCMSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c9-6-4-2-1-3-5(6)7-8(10)11/h1-5,7H.
What are the key properties of N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide?
N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide has a molecular weight of 154.12 g/mol, XLogP of -0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-oxocyclohexa-2,4-dien-1-yl)nitramide is sourced from PubChem (CID 70139502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).