About cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate
cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate (PubChem CID 70139547) has the molecular formula C28H24O4
and a molecular weight of 424.50 g/mol. Its IUPAC name is cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate |
| PubChem CID | 70139547 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate |
| SMILES | CC(=O)Oc1ccc2c(c1C(=O)OC1CC1)C=CC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C28H24O4/c1-19(29)31-25-15-12-20-18-28(21-8-4-2-5-9-21,22-10-6-3-7-11-22)17-16-24(20)26(25)27(30)32-23-13-14-23/h2-12,15-17,23H,13-14,18H2,1H3 |
| InChIKey | HOOVLROZVIRJMN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate?
The IUPAC name of cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate (CID 70139547) is cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate.
What is the SMILES notation for cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate?
The canonical SMILES for cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate is CC(=O)Oc1ccc2c(c1C(=O)OC1CC1)C=CC(c1ccccc1)(c1ccccc1)C2.
What is the InChIKey of cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate?
The InChIKey is HOOVLROZVIRJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24O4/c1-19(29)31-25-15-12-20-18-28(21-8-4-2-5-9-21,22-10-6-3-7-11-22)17-16-24(20)26(25)27(30)32-23-13-14-23/h2-12,15-17,23H,13-14,18H2,1H3.
What are the key properties of cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate?
cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate has a molecular weight of 424.50 g/mol, XLogP of 5.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl 2-acetyloxy-6,6-diphenyl-5H-naphthalene-1-carboxylate is sourced from PubChem (CID 70139547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).