About cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane
cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane (PubChem CID 70140056) has the molecular formula C18H32O2Si2
and a molecular weight of 336.62 g/mol. Its IUPAC name is cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane.
Molecular Properties
| Compound Name | cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane |
| PubChem CID | 70140056 |
| Molecular Formula | C18H32O2Si2 |
| Molecular Weight | 336.62 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane |
| SMILES | C1=CCCC=C1.C[Si](C)(C)OC1C=CC=CC1O[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2Si2.C6H8/c1-15(2,3)13-11-9-7-8-10-12(11)14-16(4,5)6;1-2-4-6-5-3-1/h7-12H,1-6H3;1-4H,5-6H2 |
| InChIKey | VZDJAKPLEKTPJS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane?
The IUPAC name of cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane (CID 70140056) is cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane.
What is the SMILES notation for cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane?
The canonical SMILES for cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane is C1=CCCC=C1.C[Si](C)(C)OC1C=CC=CC1O[Si](C)(C)C.
What is the InChIKey of cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane?
The InChIKey is VZDJAKPLEKTPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2Si2.C6H8/c1-15(2,3)13-11-9-7-8-10-12(11)14-16(4,5)6;1-2-4-6-5-3-1/h7-12H,1-6H3;1-4H,5-6H2.
What are the key properties of cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane?
cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane has a molecular weight of 336.62 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-diene;trimethyl-(6-trimethylsilyloxycyclohexa-2,4-dien-1-yl)oxysilane is sourced from PubChem (CID 70140056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).