About 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone
1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone (PubChem CID 70140805) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone |
| PubChem CID | 70140805 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone |
| SMILES | CC(=O)C1CN=C(N)C1 |
| InChI | InChI=1S/C6H10N2O/c1-4(9)5-2-6(7)8-3-5/h5H,2-3H2,1H3,(H2,7,8) |
| InChIKey | PPSDYWBBWYQBBV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone?
The IUPAC name of 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone (CID 70140805) is 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone.
What is the SMILES notation for 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone?
The canonical SMILES for 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone is CC(=O)C1CN=C(N)C1.
What is the InChIKey of 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone?
The InChIKey is PPSDYWBBWYQBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-4(9)5-2-6(7)8-3-5/h5H,2-3H2,1H3,(H2,7,8).
What are the key properties of 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone?
1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone has a molecular weight of 126.16 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)ethanone is sourced from PubChem (CID 70140805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).