C14H21F6N6O+ — CID 7014094
N-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-1,3,5-triazin-2-amine (PubChem CID 7014094) has the molecular formula C14H21F6N6O+ and a molecular weight of 403.35 g/mol. Its IUPAC name is N-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 7014094 |
| Molecular Formula | C14H21F6N6O+ |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N2CC[NH2+]CC2)n1 |
| InChI | InChI=1S/C14H20F6N6O/c1-2-3-4-22-10-23-11(26-7-5-21-6-8-26)25-12(24-10)27-9(13(15,16)17)14(18,19)20/h9,21H,2-8H2,1H3,(H,22,23,24,25)/p+1 |
| InChIKey | BKCZECLCJIGYJF-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|