C31H32F3N5O2 — CID 70140970
[9-[4-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70140970) has the molecular formula C31H32F3N5O2 and a molecular weight of 563.62 g/mol. Its IUPAC name is [9-[4-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70140970 |
| Molecular Formula | C31H32F3N5O2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | [9-[4-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC1(CCCCN2CCN(c3nc4ccccc4[nH]3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H32F3N5O2/c32-31(33,34)21-35-29(40)41-30(24-11-3-1-9-22(24)23-10-2-4-12-25(23)30)15-7-8-16-38-17-19-39(20-18-38)28-36-26-13-5-6-14-27(26)37-28/h1-6,9-14H,7-8,15-21H2,(H,35,40)(H,36,37) |
| InChIKey | JUVRIYVIUREMGB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|