C16H16O4 — CID 70141168
2,6-diethylnaphthalene-1,8-dicarboxylic acid (PubChem CID 70141168) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2,6-diethylnaphthalene-1,8-dicarboxylic acid.
| Compound Name | 2,6-diethylnaphthalene-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 70141168 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2,6-diethylnaphthalene-1,8-dicarboxylic acid |
| SMILES | CCc1cc(C(=O)O)c2c(C(=O)O)c(CC)ccc2c1 |
| InChI | InChI=1S/C16H16O4/c1-3-9-7-11-6-5-10(4-2)14(16(19)20)13(11)12(8-9)15(17)18/h5-8H,3-4H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | JVFORSQKBNQGAN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |