C33H33F3N4O3 — CID 70141174
[9-[4-[4-(8-hydroxyquinolin-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70141174) has the molecular formula C33H33F3N4O3 and a molecular weight of 590.65 g/mol. Its IUPAC name is [9-[4-[4-(8-hydroxyquinolin-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-[4-(8-hydroxyquinolin-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70141174 |
| Molecular Formula | C33H33F3N4O3 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | [9-[4-[4-(8-hydroxyquinolin-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC1(CCCCN2CCN(c3ccc4cccc(O)c4n3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H33F3N4O3/c34-33(35,36)22-37-31(42)43-32(26-11-3-1-9-24(26)25-10-2-4-12-27(25)32)16-5-6-17-39-18-20-40(21-19-39)29-15-14-23-8-7-13-28(41)30(23)38-29/h1-4,7-15,41H,5-6,16-22H2,(H,37,42) |
| InChIKey | FLVCEAQZKDAMNX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|