C18H17F2N3O4 — CID 70141442
3-[3,5-difluoro-4-(1,2,3,4-tetrahydropyridin-4-yl)phenyl]-4-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 70141442) has the molecular formula C18H17F2N3O4 and a molecular weight of 377.35 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(1,2,3,4-tetrahydropyridin-4-yl)phenyl]-4-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[3,5-difluoro-4-(1,2,3,4-tetrahydropyridin-4-yl)phenyl]-4-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70141442 |
| Molecular Formula | C18H17F2N3O4 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[3,5-difluoro-4-(1,2,3,4-tetrahydropyridin-4-yl)phenyl]-4-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCC(COc2ccon2)N1c1cc(F)c(C2C=CNCC2)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O4/c19-14-7-12(8-15(20)17(14)11-1-4-21-5-2-11)23-13(10-26-18(23)24)9-25-16-3-6-27-22-16/h1,3-4,6-8,11,13,21H,2,5,9-10H2 |
| InChIKey | IMQPISBLTFPIIE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |