C26H32B2N2O4 — CID 70141671
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline (PubChem CID 70141671) has the molecular formula C26H32B2N2O4 and a molecular weight of 458.18 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline |
|---|---|
| PubChem CID | 70141671 |
| Molecular Formula | C26H32B2N2O4 |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline |
| SMILES | CC1(C)OB(c2ccc(-c3ncc4cc(B5OC(C)(C)C(C)(C)O5)ccc4n3)cc2)OC1(C)C |
| InChI | InChI=1S/C26H32B2N2O4/c1-23(2)24(3,4)32-27(31-23)19-11-9-17(10-12-19)22-29-16-18-15-20(13-14-21(18)30-22)28-33-25(5,6)26(7,8)34-28/h9-16H,1-8H3 |
| InChIKey | JIOWORJTWOPWLR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|