About N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide
N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 70141704) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 70141704 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | CCNC(=O)C1(CC)C=CC=C(C)C1 |
| InChI | InChI=1S/C12H19NO/c1-4-12(11(14)13-5-2)8-6-7-10(3)9-12/h6-8H,4-5,9H2,1-3H3,(H,13,14) |
| InChIKey | PAFKNZKYRCGBNE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide (CID 70141704) is N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide is CCNC(=O)C1(CC)C=CC=C(C)C1.
What is the InChIKey of N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide?
The InChIKey is PAFKNZKYRCGBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-4-12(11(14)13-5-2)8-6-7-10(3)9-12/h6-8H,4-5,9H2,1-3H3,(H,13,14).
What are the key properties of N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide?
N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide has a molecular weight of 193.29 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-diethyl-5-methylcyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 70141704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).