C12H19ClN2O — CID 70142040
[(2R)-1-[(3-aminophenyl)methyl]pyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 70142040) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is [(2R)-1-[(3-aminophenyl)methyl]pyrrolidin-2-yl]methanol;hydrochloride.
| Compound Name | [(2R)-1-[(3-aminophenyl)methyl]pyrrolidin-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 70142040 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [(2R)-1-[(3-aminophenyl)methyl]pyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | Cl.Nc1cccc(CN2CCC[C@@H]2CO)c1 |
| InChI | InChI=1S/C12H18N2O.ClH/c13-11-4-1-3-10(7-11)8-14-6-2-5-12(14)9-15;/h1,3-4,7,12,15H,2,5-6,8-9,13H2;1H/t12-;/m1./s1 |
| InChIKey | YALNSUWFDWIGAB-UTONKHPSSA-N |
| XLogP | 1.65 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|