C24H28F3N3O2 — CID 70142272
[9-(4-piperazin-1-ylbutyl)fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70142272) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is [9-(4-piperazin-1-ylbutyl)fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-(4-piperazin-1-ylbutyl)fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70142272 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [9-(4-piperazin-1-ylbutyl)fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC1(CCCCN2CCNCC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H28F3N3O2/c25-24(26,27)17-29-22(31)32-23(11-5-6-14-30-15-12-28-13-16-30)20-9-3-1-7-18(20)19-8-2-4-10-21(19)23/h1-4,7-10,28H,5-6,11-17H2,(H,29,31) |
| InChIKey | XRDYUEVUYJJUSB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|