About 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione
1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione (PubChem CID 70143161) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione |
| PubChem CID | 70143161 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(C(O)/C=C/O)C(=O)N1 |
| InChI | InChI=1S/C6H8N2O4/c9-2-1-5(11)8-3-4(10)7-6(8)12/h1-2,5,9,11H,3H2,(H,7,10,12)/b2-1+ |
| InChIKey | ZIHSSEUTHLQBSI-OWOJBTEDSA-N |
| XLogP | -1.07 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione?
The IUPAC name of 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione (CID 70143161) is 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione.
What is the SMILES notation for 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione?
The canonical SMILES for 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione is O=C1CN(C(O)/C=C/O)C(=O)N1.
What is the InChIKey of 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione?
The InChIKey is ZIHSSEUTHLQBSI-OWOJBTEDSA-N. The full InChI is InChI=1S/C6H8N2O4/c9-2-1-5(11)8-3-4(10)7-6(8)12/h1-2,5,9,11H,3H2,(H,7,10,12)/b2-1+.
What are the key properties of 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione?
1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione has a molecular weight of 172.14 g/mol, XLogP of -1.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,3-dihydroxyprop-2-enyl]imidazolidine-2,4-dione is sourced from PubChem (CID 70143161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).