C13H19NO — CID 7014322
(2S)-N-(2-methoxyethyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 7014322) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2S)-N-(2-methoxyethyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-N-(2-methoxyethyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 7014322 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2S)-N-(2-methoxyethyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COCCN[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H19NO/c1-15-9-8-14-13-7-6-11-4-2-3-5-12(11)10-13/h2-5,13-14H,6-10H2,1H3/t13-/m0/s1 |
| InChIKey | KCZWUGOVLFXUDH-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|