C12H13N3O7 — CID 70143351
[acetyloxy-(4,6-dimethyl-5,7-dioxo-[1,3]oxazolo[5,4-d]pyrimidin-2-yl)methyl] acetate (PubChem CID 70143351) has the molecular formula C12H13N3O7 and a molecular weight of 311.25 g/mol. Its IUPAC name is [acetyloxy-(4,6-dimethyl-5,7-dioxo-[1,3]oxazolo[5,4-d]pyrimidin-2-yl)methyl] acetate.
| Compound Name | [acetyloxy-(4,6-dimethyl-5,7-dioxo-[1,3]oxazolo[5,4-d]pyrimidin-2-yl)methyl] acetate |
|---|---|
| PubChem CID | 70143351 |
| Molecular Formula | C12H13N3O7 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [acetyloxy-(4,6-dimethyl-5,7-dioxo-[1,3]oxazolo[5,4-d]pyrimidin-2-yl)methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)c1nc2c(=O)n(C)c(=O)n(C)c2o1 |
| InChI | InChI=1S/C12H13N3O7/c1-5(16)20-11(21-6(2)17)8-13-7-9(18)14(3)12(19)15(4)10(7)22-8/h11H,1-4H3 |
| InChIKey | RGDAQHFUAMONIX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 122.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|