About 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol
4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol (PubChem CID 70143948) has the molecular formula C19H20O4
and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol |
| PubChem CID | 70143948 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol |
| SMILES | COc1ccc(Cc2ccc(O)cc2)c2c1OC1(CCCC1)O2 |
| InChI | InChI=1S/C19H20O4/c1-21-16-9-6-14(12-13-4-7-15(20)8-5-13)17-18(16)23-19(22-17)10-2-3-11-19/h4-9,20H,2-3,10-12H2,1H3 |
| InChIKey | PEFZJLKBTUPHQN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol?
The IUPAC name of 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol (CID 70143948) is 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol.
What is the SMILES notation for 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol?
The canonical SMILES for 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol is COc1ccc(Cc2ccc(O)cc2)c2c1OC1(CCCC1)O2.
What is the InChIKey of 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol?
The InChIKey is PEFZJLKBTUPHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4/c1-21-16-9-6-14(12-13-4-7-15(20)8-5-13)17-18(16)23-19(22-17)10-2-3-11-19/h4-9,20H,2-3,10-12H2,1H3.
What are the key properties of 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol?
4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol has a molecular weight of 312.37 g/mol, XLogP of 4.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-methoxyspiro[1,3-benzodioxole-2,1'-cyclopentane]-4-yl)methyl]phenol is sourced from PubChem (CID 70143948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).