About 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride
3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride (PubChem CID 70144025) has the molecular formula C14H21ClN2O4
and a molecular weight of 316.78 g/mol. Its IUPAC name is 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride |
| PubChem CID | 70144025 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.NCCCCCC(=O)NCc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C14H20N2O4.ClH/c15-8-3-1-2-7-12(17)16-9-10-5-4-6-11(13(10)18)14(19)20;/h4-6,18H,1-3,7-9,15H2,(H,16,17)(H,19,20);1H |
| InChIKey | GXZBJMSORHUAIE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride?
The IUPAC name of 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride (CID 70144025) is 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride.
What is the SMILES notation for 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride?
The canonical SMILES for 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride is Cl.NCCCCCC(=O)NCc1cccc(C(=O)O)c1O.
What is the InChIKey of 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride?
The InChIKey is GXZBJMSORHUAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4.ClH/c15-8-3-1-2-7-12(17)16-9-10-5-4-6-11(13(10)18)14(19)20;/h4-6,18H,1-3,7-9,15H2,(H,16,17)(H,19,20);1H.
What are the key properties of 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride?
3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride has a molecular weight of 316.78 g/mol, XLogP of 1.65, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-aminohexanoylamino)methyl]-2-hydroxybenzoic acid;hydrochloride is sourced from PubChem (CID 70144025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).