C32H32F3N5O3 — CID 70144189
[9-[4-(4-quinazolin-2-ylpiperazin-1-yl)butyl]xanthen-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70144189) has the molecular formula C32H32F3N5O3 and a molecular weight of 591.63 g/mol. Its IUPAC name is [9-[4-(4-quinazolin-2-ylpiperazin-1-yl)butyl]xanthen-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-(4-quinazolin-2-ylpiperazin-1-yl)butyl]xanthen-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70144189 |
| Molecular Formula | C32H32F3N5O3 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | [9-[4-(4-quinazolin-2-ylpiperazin-1-yl)butyl]xanthen-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC1(CCCCN2CCN(c3ncc4ccccc4n3)CC2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C32H32F3N5O3/c33-32(34,35)22-37-30(41)43-31(24-10-2-5-13-27(24)42-28-14-6-3-11-25(28)31)15-7-8-16-39-17-19-40(20-18-39)29-36-21-23-9-1-4-12-26(23)38-29/h1-6,9-14,21H,7-8,15-20,22H2,(H,37,41) |
| InChIKey | SDXSUOKVSYWGKB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|