About (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine
(4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine (PubChem CID 70144286) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine |
| PubChem CID | 70144286 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine |
| SMILES | NCC1=CCC(F)(F)C=C1 |
| InChI | InChI=1S/C7H9F2N/c8-7(9)3-1-6(5-10)2-4-7/h1-3H,4-5,10H2 |
| InChIKey | XYMXHEQWXNFBMN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
The IUPAC name of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine (CID 70144286) is (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine.
What is the SMILES notation for (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
The canonical SMILES for (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine is NCC1=CCC(F)(F)C=C1.
What is the InChIKey of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
The InChIKey is XYMXHEQWXNFBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N/c8-7(9)3-1-6(5-10)2-4-7/h1-3H,4-5,10H2.
What are the key properties of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
(4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine has a molecular weight of 145.15 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexa-1,5-dien-1-yl)methanamine is sourced from PubChem (CID 70144286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).