C26H19FN2O3 — CID 70145402
3-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile (PubChem CID 70145402) has the molecular formula C26H19FN2O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile.
| Compound Name | 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 70145402 |
| Molecular Formula | C26H19FN2O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-6-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile |
| SMILES | N#Cc1cc2c(cc1-c1ccc(F)cc1)COC2CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H19FN2O3/c27-19-9-7-16(8-10-19)22-13-18-15-32-24(23(18)12-17(22)14-28)6-3-11-29-25(30)20-4-1-2-5-21(20)26(29)31/h1-2,4-5,7-10,12-13,24H,3,6,11,15H2 |
| InChIKey | LBMBYEJILXEFOJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|