C21H27N3O5S — CID 70145759
3-[3-(3,4-dimethylphenyl)propoxy]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid (PubChem CID 70145759) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-[3-(3,4-dimethylphenyl)propoxy]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-[3-(3,4-dimethylphenyl)propoxy]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 70145759 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-[3-(3,4-dimethylphenyl)propoxy]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
| SMILES | Cc1ccc(CCCOc2nsnc2C2=CCCN(C)C2)cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25N3OS.C2H2O4/c1-14-8-9-16(12-15(14)2)6-5-11-23-19-18(20-24-21-19)17-7-4-10-22(3)13-17;3-1(4)2(5)6/h7-9,12H,4-6,10-11,13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | AYAMFKACTAOFBT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|