About 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid
5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid (PubChem CID 70145826) has the molecular formula C18H31FN2O4
and a molecular weight of 358.45 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid.
Molecular Properties
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid |
| PubChem CID | 70145826 |
| Molecular Formula | C18H31FN2O4 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)O.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C14H28O2.C4H3FN2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;5-2-1-6-4(9)7-3(2)8/h2-13H2,1H3,(H,15,16);1H,(H2,6,7,8,9) |
| InChIKey | WDQCVSKYDPYZKV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid?
The IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid (CID 70145826) is 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid.
What is the SMILES notation for 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid?
The canonical SMILES for 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid is CCCCCCCCCCCCCC(=O)O.O=c1[nH]cc(F)c(=O)[nH]1.
What is the InChIKey of 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid?
The InChIKey is WDQCVSKYDPYZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C4H3FN2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;5-2-1-6-4(9)7-3(2)8/h2-13H2,1H3,(H,15,16);1H,(H2,6,7,8,9).
What are the key properties of 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid?
5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid has a molecular weight of 358.45 g/mol, XLogP of 3.97, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-pyrimidine-2,4-dione;tetradecanoic acid is sourced from PubChem (CID 70145826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).