C23H37NO2 — CID 70146678
(1S,3aS,3bR,4S,5aR,9aR,9bS,11aS)-1-cyclopropyloxy-4-ethyl-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinolin-7-one (PubChem CID 70146678) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (1S,3aS,3bR,4S,5aR,9aR,9bS,11aS)-1-cyclopropyloxy-4-ethyl-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (1S,3aS,3bR,4S,5aR,9aR,9bS,11aS)-1-cyclopropyloxy-4-ethyl-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70146678 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (1S,3aS,3bR,4S,5aR,9aR,9bS,11aS)-1-cyclopropyloxy-4-ethyl-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CC[C@H]1C[C@H]2NC(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H](OC4CC4)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C23H37NO2/c1-4-14-13-18-22(2,12-10-20(25)24-18)17-9-11-23(3)16(21(14)17)7-8-19(23)26-15-5-6-15/h14-19,21H,4-13H2,1-3H3,(H,24,25)/t14-,16-,17-,18+,19-,21-,22+,23-/m0/s1 |
| InChIKey | KEDGINXRTZPEGZ-IKMLEHLISA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |