About 5-acetyloxolan-2-one;oxolan-2-one
5-acetyloxolan-2-one;oxolan-2-one (PubChem CID 70146816) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is 5-acetyloxolan-2-one;oxolan-2-one.
Molecular Properties
| Compound Name | 5-acetyloxolan-2-one;oxolan-2-one |
| PubChem CID | 70146816 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5-acetyloxolan-2-one;oxolan-2-one |
| SMILES | CC(=O)C1CCC(=O)O1.O=C1CCCO1 |
| InChI | InChI=1S/C6H8O3.C4H6O2/c1-4(7)5-2-3-6(8)9-5;5-4-2-1-3-6-4/h5H,2-3H2,1H3;1-3H2 |
| InChIKey | WZHDOFMPSOTZRV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-acetyloxolan-2-one;oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyloxolan-2-one;oxolan-2-one?
The IUPAC name of 5-acetyloxolan-2-one;oxolan-2-one (CID 70146816) is 5-acetyloxolan-2-one;oxolan-2-one.
What is the SMILES notation for 5-acetyloxolan-2-one;oxolan-2-one?
The canonical SMILES for 5-acetyloxolan-2-one;oxolan-2-one is CC(=O)C1CCC(=O)O1.O=C1CCCO1.
What is the InChIKey of 5-acetyloxolan-2-one;oxolan-2-one?
The InChIKey is WZHDOFMPSOTZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.C4H6O2/c1-4(7)5-2-3-6(8)9-5;5-4-2-1-3-6-4/h5H,2-3H2,1H3;1-3H2.
What are the key properties of 5-acetyloxolan-2-one;oxolan-2-one?
5-acetyloxolan-2-one;oxolan-2-one has a molecular weight of 214.22 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyloxolan-2-one;oxolan-2-one is sourced from PubChem (CID 70146816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).