C15H23NO7 — CID 70146832
[(2R,3S,4R,5R,6S)-5-acetamido-4-acetyloxy-3-hydroxy-6-prop-2-enyloxan-2-yl]methyl acetate (PubChem CID 70146832) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-4-acetyloxy-3-hydroxy-6-prop-2-enyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-4-acetyloxy-3-hydroxy-6-prop-2-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70146832 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-4-acetyloxy-3-hydroxy-6-prop-2-enyloxan-2-yl]methyl acetate |
| SMILES | C=CC[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](OC(C)=O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C15H23NO7/c1-5-6-11-13(16-8(2)17)15(22-10(4)19)14(20)12(23-11)7-21-9(3)18/h5,11-15,20H,1,6-7H2,2-4H3,(H,16,17)/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | SKIMGJZDXWYNHI-NJVJYBDUSA-N |
| XLogP | -0.31 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|