C32H53N5O6 — CID 70147512
3-[[2-[[(3R)-2-[(2-acetamido-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-cyclohexylpropanoyl]amino]-2-oxo-3-prop-2-enylhex-5-enamide (PubChem CID 70147512) has the molecular formula C32H53N5O6 and a molecular weight of 603.81 g/mol. Its IUPAC name is 3-[[2-[[(3R)-2-[(2-acetamido-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-cyclohexylpropanoyl]amino]-2-oxo-3-prop-2-enylhex-5-enamide.
| Compound Name | 3-[[2-[[(3R)-2-[(2-acetamido-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-cyclohexylpropanoyl]amino]-2-oxo-3-prop-2-enylhex-5-enamide |
|---|---|
| PubChem CID | 70147512 |
| Molecular Formula | C32H53N5O6 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.40 |
| IUPAC Name | 3-[[2-[[(3R)-2-[(2-acetamido-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-cyclohexylpropanoyl]amino]-2-oxo-3-prop-2-enylhex-5-enamide |
| SMILES | C=CCC(CC=C)(NC(=O)C(CC1CCCCC1)NC(=O)C(NC(=O)C(CC(C)C)NC(C)=O)[C@H](C)CC)C(=O)C(N)=O |
| InChI | InChI=1S/C32H53N5O6/c1-8-16-32(17-9-2,27(39)28(33)40)37-30(42)25(19-23-14-12-11-13-15-23)35-31(43)26(21(6)10-3)36-29(41)24(18-20(4)5)34-22(7)38/h8-9,20-21,23-26H,1-2,10-19H2,3-7H3,(H2,33,40)(H,34,38)(H,35,43)(H,36,41)(H,37,42)/t21-,24?,25?,26?/m1/s1 |
| InChIKey | OZACCHVJTOFFBZ-KVNNJQQXSA-N |
| XLogP | 2.58 |
| TPSA | 176.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|