C28H40O2 — CID 70147871
(8S,9S,10R,13S,14S,17R)-17-[1-(3-hydroxyphenyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-ol (PubChem CID 70147871) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-[1-(3-hydroxyphenyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-[1-(3-hydroxyphenyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 70147871 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-[1-(3-hydroxyphenyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-ol |
| SMILES | CC(Cc1cccc(O)c1)[C@H]1C(O)C[C@H]2[C@@H]3CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H40O2/c1-18(15-19-7-6-9-21(29)16-19)26-25(30)17-24-22-11-10-20-8-4-5-13-27(20,2)23(22)12-14-28(24,26)3/h6-7,9-10,16,18,22-26,29-30H,4-5,8,11-15,17H2,1-3H3/t18?,22-,23+,24+,25?,26+,27+,28+/m1/s1 |
| InChIKey | CPKMSYSDTKBBDZ-SCPWMMDYSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|