About 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid
2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid (PubChem CID 70148164) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid.
Analyze 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid?
The IUPAC name of 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid (CID 70148164) is 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid.
What is the SMILES notation for 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid?
The canonical SMILES for 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid is NC1=NCCCC1OCC(=O)O.
What is the InChIKey of 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid?
The InChIKey is RCVNIZLKTIYIBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c8-7-5(2-1-3-9-7)12-4-6(10)11/h5H,1-4H2,(H2,8,9)(H,10,11).
What are the key properties of 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid?
2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid has a molecular weight of 172.18 g/mol, XLogP of -0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetic acid is sourced from PubChem (CID 70148164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).