About N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide
N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide (PubChem CID 70148261) has the molecular formula C25H37IN2O4Si
and a molecular weight of 584.57 g/mol. Its IUPAC name is N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide.
Molecular Properties
| Compound Name | N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide |
| PubChem CID | 70148261 |
| Molecular Formula | C25H37IN2O4Si |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide |
| SMILES | C=CC(=O)Nc1ccc(C(c2ccccc2)C(CCN)[Si](OCC)(OCC)OCC)cc1.I |
| InChI | InChI=1S/C25H36N2O4Si.HI/c1-5-24(28)27-22-16-14-21(15-17-22)25(20-12-10-9-11-13-20)23(18-19-26)32(29-6-2,30-7-3)31-8-4;/h5,9-17,23,25H,1,6-8,18-19,26H2,2-4H3,(H,27,28);1H |
| InChIKey | ZQNDEPJCTPTJBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide?
The IUPAC name of N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide (CID 70148261) is N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide.
What is the SMILES notation for N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide?
The canonical SMILES for N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide is C=CC(=O)Nc1ccc(C(c2ccccc2)C(CCN)[Si](OCC)(OCC)OCC)cc1.I.
What is the InChIKey of N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide?
The InChIKey is ZQNDEPJCTPTJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36N2O4Si.HI/c1-5-24(28)27-22-16-14-21(15-17-22)25(20-12-10-9-11-13-20)23(18-19-26)32(29-6-2,30-7-3)31-8-4;/h5,9-17,23,25H,1,6-8,18-19,26H2,2-4H3,(H,27,28);1H.
What are the key properties of N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide?
N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide has a molecular weight of 584.57 g/mol, XLogP of 5.33, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-amino-1-phenyl-2-triethoxysilylbutyl)phenyl]prop-2-enamide;hydroiodide is sourced from PubChem (CID 70148261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).