C20H22N6O2 — CID 70148422
4-(3,5-dimethylphenyl)-N-(2-hydroxy-1,2,4-benzotriazin-3-ylidene)piperazine-1-carboxamide (PubChem CID 70148422) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-N-(2-hydroxy-1,2,4-benzotriazin-3-ylidene)piperazine-1-carboxamide.
| Compound Name | 4-(3,5-dimethylphenyl)-N-(2-hydroxy-1,2,4-benzotriazin-3-ylidene)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70148422 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-N-(2-hydroxy-1,2,4-benzotriazin-3-ylidene)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)cc(N2CCN(C(=O)N=c3nc4ccccc4nn3O)CC2)c1 |
| InChI | InChI=1S/C20H22N6O2/c1-14-11-15(2)13-16(12-14)24-7-9-25(10-8-24)20(27)22-19-21-17-5-3-4-6-18(17)23-26(19)28/h3-6,11-13,28H,7-10H2,1-2H3 |
| InChIKey | IQPBHNCYXJFZCJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|