About 4-N-methylcyclohexa-2,5-diene-1,4-diimine
4-N-methylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 70148626) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 4-N-methylcyclohexa-2,5-diene-1,4-diimine.
Molecular Properties
| Compound Name | 4-N-methylcyclohexa-2,5-diene-1,4-diimine |
| PubChem CID | 70148626 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 4-N-methylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]N=C1C=CC(=NC)C=C1 |
| InChI | InChI=1S/C7H8N2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3/b8-6-,9-7+ |
| InChIKey | KJJJYSZACWEXJY-MKKAVFGOSA-N |
| XLogP | 1.20 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-N-methylcyclohexa-2,5-diene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methylcyclohexa-2,5-diene-1,4-diimine?
The IUPAC name of 4-N-methylcyclohexa-2,5-diene-1,4-diimine (CID 70148626) is 4-N-methylcyclohexa-2,5-diene-1,4-diimine.
What is the SMILES notation for 4-N-methylcyclohexa-2,5-diene-1,4-diimine?
The canonical SMILES for 4-N-methylcyclohexa-2,5-diene-1,4-diimine is [H]N=C1C=CC(=NC)C=C1.
What is the InChIKey of 4-N-methylcyclohexa-2,5-diene-1,4-diimine?
The InChIKey is KJJJYSZACWEXJY-MKKAVFGOSA-N. The full InChI is InChI=1S/C7H8N2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3/b8-6-,9-7+.
What are the key properties of 4-N-methylcyclohexa-2,5-diene-1,4-diimine?
4-N-methylcyclohexa-2,5-diene-1,4-diimine has a molecular weight of 120.15 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methylcyclohexa-2,5-diene-1,4-diimine is sourced from PubChem (CID 70148626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).