C8H5F5O — CID 7014870
(1R)-1-(2,3,4,5,6-pentafluorophenyl)ethanol (PubChem CID 7014870) has the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. Its IUPAC name is (1R)-1-(2,3,4,5,6-pentafluorophenyl)ethanol.
| Compound Name | (1R)-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
|---|---|
| PubChem CID | 7014870 |
| Molecular Formula | C8H5F5O |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | (1R)-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
| SMILES | C[C@@H](O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h2,14H,1H3/t2-/m1/s1 |
| InChIKey | WYUNHWKTLDBPLE-UWTATZPHSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|