About 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid
4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 70148737) has the molecular formula C28H26O2
and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid |
| PubChem CID | 70148737 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(c1cccc(C)c1)=CCC2(C)C |
| InChI | InChI=1S/C28H26O2/c1-18-6-5-7-23(16-18)24-14-15-28(3,4)26-13-12-22(17-25(24)26)19(2)20-8-10-21(11-9-20)27(29)30/h5-14,16-17H,2,15H2,1,3-4H3,(H,29,30) |
| InChIKey | XPFSEJMQXMHDMV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid?
The IUPAC name of 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid (CID 70148737) is 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid.
What is the SMILES notation for 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid?
The canonical SMILES for 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid is C=C(c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(c1cccc(C)c1)=CCC2(C)C.
What is the InChIKey of 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid?
The InChIKey is XPFSEJMQXMHDMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O2/c1-18-6-5-7-23(16-18)24-14-15-28(3,4)26-13-12-22(17-25(24)26)19(2)20-8-10-21(11-9-20)27(29)30/h5-14,16-17H,2,15H2,1,3-4H3,(H,29,30).
What are the key properties of 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid?
4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid has a molecular weight of 394.51 g/mol, XLogP of 6.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[5,5-dimethyl-8-(3-methylphenyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid is sourced from PubChem (CID 70148737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).