C36H45Cl2N5O5S — CID 70149239
4-(2,6-dichlorophenyl)-2-[2-[4-[8-(diethylamino)-3-bicyclo[3.2.1]octanyl]piperazin-1-yl]-2-oxoethyl]-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70149239) has the molecular formula C36H45Cl2N5O5S and a molecular weight of 730.76 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2-[2-[4-[8-(diethylamino)-3-bicyclo[3.2.1]octanyl]piperazin-1-yl]-2-oxoethyl]-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(2,6-dichlorophenyl)-2-[2-[4-[8-(diethylamino)-3-bicyclo[3.2.1]octanyl]piperazin-1-yl]-2-oxoethyl]-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70149239 |
| Molecular Formula | C36H45Cl2N5O5S |
| Molecular Weight | 730.76 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2-[2-[4-[8-(diethylamino)-3-bicyclo[3.2.1]octanyl]piperazin-1-yl]-2-oxoethyl]-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CCN(CC)C1C2CCC1CC(N1CCN(C(=O)CC3=C(C(=O)O)C(c4c(Cl)cccc4Cl)C(C(=O)O)=C(CCc4nccs4)N3)CC1)C2 |
| InChI | InChI=1S/C36H45Cl2N5O5S/c1-3-41(4-2)34-21-8-9-22(34)19-23(18-21)42-13-15-43(16-14-42)29(44)20-27-32(36(47)48)33(30-24(37)6-5-7-25(30)38)31(35(45)46)26(40-27)10-11-28-39-12-17-49-28/h5-7,12,17,21-23,33-34,40H,3-4,8-11,13-16,18-20H2,1-2H3,(H,45,46)(H,47,48) |
| InChIKey | QEZFUFOIUYQVFQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.76 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |