C38H51N5 — CID 70149437
butan-1-amine;2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropylporphyrin (PubChem CID 70149437) has the molecular formula C38H51N5 and a molecular weight of 577.86 g/mol. Its IUPAC name is butan-1-amine;2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropylporphyrin.
| Compound Name | butan-1-amine;2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropylporphyrin |
|---|---|
| PubChem CID | 70149437 |
| Molecular Formula | C38H51N5 |
| Molecular Weight | 577.86 g/mol |
| Exact Mass | 577.41 |
| IUPAC Name | butan-1-amine;2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropylporphyrin |
| SMILES | CCCC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(CCC)=C5C)C(C)=C4CC)C(C)=C3CC.CCCCN |
| InChI | InChI=1S/C34H40N4.C4H11N/c1-9-13-25-21(7)28-15-27-19(5)23(11-3)31(35-27)16-29-20(6)24(12-4)32(36-29)17-30-22(8)26(14-10-2)34(38-30)18-33(25)37-28;1-2-3-4-5/h15-18H,9-14H2,1-8H3;2-5H2,1H3/b27-15-,28-15-,29-16-,30-17-,31-16-,32-17-,33-18-,34-18-; |
| InChIKey | OSFSYIWJEAMDLE-YPFLCKFZSA-N |
| XLogP | 9.79 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.86 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |