C17H16Cl2Si — CID 70149734
2,2-dichloro-4,4-dimethyl-4-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene (PubChem CID 70149734) has the molecular formula C17H16Cl2Si and a molecular weight of 319.31 g/mol. Its IUPAC name is 2,2-dichloro-4,4-dimethyl-4-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene.
| Compound Name | 2,2-dichloro-4,4-dimethyl-4-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene |
|---|---|
| PubChem CID | 70149734 |
| Molecular Formula | C17H16Cl2Si |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2,2-dichloro-4,4-dimethyl-4-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene |
| SMILES | C[Si]1(C)CC(Cl)(Cl)C2c3ccccc3-c3cccc1c32 |
| InChI | InChI=1S/C17H16Cl2Si/c1-20(2)10-17(18,19)16-13-7-4-3-6-11(13)12-8-5-9-14(20)15(12)16/h3-9,16H,10H2,1-2H3 |
| InChIKey | RNQMOXIQTSKXAC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|