C28H24ClNO6 — CID 70150023
carbonic acid;2-[(1S,2R,3R)-3-[4-(3-chlorophenyl)benzoyl]-2-methylcyclopentyl]isoindole-1,3-dione (PubChem CID 70150023) has the molecular formula C28H24ClNO6 and a molecular weight of 505.95 g/mol. Its IUPAC name is carbonic acid;2-[(1S,2R,3R)-3-[4-(3-chlorophenyl)benzoyl]-2-methylcyclopentyl]isoindole-1,3-dione.
| Compound Name | carbonic acid;2-[(1S,2R,3R)-3-[4-(3-chlorophenyl)benzoyl]-2-methylcyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70150023 |
| Molecular Formula | C28H24ClNO6 |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | carbonic acid;2-[(1S,2R,3R)-3-[4-(3-chlorophenyl)benzoyl]-2-methylcyclopentyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](C(=O)c2ccc(-c3cccc(Cl)c3)cc2)CC[C@@H]1N1C(=O)c2ccccc2C1=O.O=C(O)O |
| InChI | InChI=1S/C27H22ClNO3.CH2O3/c1-16-21(13-14-24(16)29-26(31)22-7-2-3-8-23(22)27(29)32)25(30)18-11-9-17(10-12-18)19-5-4-6-20(28)15-19;2-1(3)4/h2-12,15-16,21,24H,13-14H2,1H3;(H2,2,3,4)/t16-,21-,24+;/m1./s1 |
| InChIKey | OOMYIIORQNJOCQ-PTMFYGODSA-N |
| XLogP | 6.12 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|