About 4,7-phenanthroline-5,6-dione
4,7-phenanthroline-5,6-dione (PubChem CID 70150060) has the molecular formula C24H12N4O4
and a molecular weight of 420.38 g/mol. Its IUPAC name is 4,7-phenanthroline-5,6-dione.
Molecular Properties
| Compound Name | 4,7-phenanthroline-5,6-dione |
| PubChem CID | 70150060 |
| Molecular Formula | C24H12N4O4 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4,7-phenanthroline-5,6-dione |
| SMILES | O=C1C(=O)c2ncccc2-c2cccnc21.O=C1C(=O)c2ncccc2-c2cccnc21 |
| InChI | InChI=1S/2C12H6N2O2/c2*15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h2*1-6H |
| InChIKey | SKINKZHNHUVZMG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 119.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,7-phenanthroline-5,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-phenanthroline-5,6-dione?
The IUPAC name of 4,7-phenanthroline-5,6-dione (CID 70150060) is 4,7-phenanthroline-5,6-dione.
What is the SMILES notation for 4,7-phenanthroline-5,6-dione?
The canonical SMILES for 4,7-phenanthroline-5,6-dione is O=C1C(=O)c2ncccc2-c2cccnc21.O=C1C(=O)c2ncccc2-c2cccnc21.
What is the InChIKey of 4,7-phenanthroline-5,6-dione?
The InChIKey is SKINKZHNHUVZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H6N2O2/c2*15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h2*1-6H.
What are the key properties of 4,7-phenanthroline-5,6-dione?
4,7-phenanthroline-5,6-dione has a molecular weight of 420.38 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-phenanthroline-5,6-dione is sourced from PubChem (CID 70150060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).