About 4-(chloromethyl)-1,2-thiazolidin-3-one
4-(chloromethyl)-1,2-thiazolidin-3-one (PubChem CID 70150343) has the molecular formula C4H6ClNOS
and a molecular weight of 151.62 g/mol. Its IUPAC name is 4-(chloromethyl)-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 4-(chloromethyl)-1,2-thiazolidin-3-one |
| PubChem CID | 70150343 |
| Molecular Formula | C4H6ClNOS |
| Molecular Weight | 151.62 g/mol |
| Exact Mass | 150.99 |
| IUPAC Name | 4-(chloromethyl)-1,2-thiazolidin-3-one |
| SMILES | O=C1NSCC1CCl |
| InChI | InChI=1S/C4H6ClNOS/c5-1-3-2-8-6-4(3)7/h3H,1-2H2,(H,6,7) |
| InChIKey | CRBTVNNAESVHSD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-1,2-thiazolidin-3-one?
The IUPAC name of 4-(chloromethyl)-1,2-thiazolidin-3-one (CID 70150343) is 4-(chloromethyl)-1,2-thiazolidin-3-one.
What is the SMILES notation for 4-(chloromethyl)-1,2-thiazolidin-3-one?
The canonical SMILES for 4-(chloromethyl)-1,2-thiazolidin-3-one is O=C1NSCC1CCl.
What is the InChIKey of 4-(chloromethyl)-1,2-thiazolidin-3-one?
The InChIKey is CRBTVNNAESVHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClNOS/c5-1-3-2-8-6-4(3)7/h3H,1-2H2,(H,6,7).
What are the key properties of 4-(chloromethyl)-1,2-thiazolidin-3-one?
4-(chloromethyl)-1,2-thiazolidin-3-one has a molecular weight of 151.62 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-1,2-thiazolidin-3-one is sourced from PubChem (CID 70150343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).