C30H35N3O8Si — CID 70150563
(19-ethyl-7-hydroxy-14,18-dioxo-16-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 70150563) has the molecular formula C30H35N3O8Si and a molecular weight of 593.71 g/mol. Its IUPAC name is (19-ethyl-7-hydroxy-14,18-dioxo-16-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | (19-ethyl-7-hydroxy-14,18-dioxo-16-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 70150563 |
| Molecular Formula | C30H35N3O8Si |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | (19-ethyl-7-hydroxy-14,18-dioxo-16-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCC1(OC(=O)CNC(=O)OC(C)(C)C)C(=O)OC([Si](C)(C)C)c2c1cc1n(c2=O)Cc2cc3cc(O)ccc3nc2-1 |
| InChI | InChI=1S/C30H35N3O8Si/c1-8-30(40-22(35)14-31-28(38)41-29(2,3)4)19-13-21-24-17(11-16-12-18(34)9-10-20(16)32-24)15-33(21)25(36)23(19)26(39-27(30)37)42(5,6)7/h9-13,26,34H,8,14-15H2,1-7H3,(H,31,38) |
| InChIKey | QPXVSUVLFONRAY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|