C14H18O6 — CID 70150898
(1R,3R,4R,5R,6R)-3-methoxy-7-phenyl-2-oxabicyclo[4.2.0]octane-4,5,6,8-tetrol (PubChem CID 70150898) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is (1R,3R,4R,5R,6R)-3-methoxy-7-phenyl-2-oxabicyclo[4.2.0]octane-4,5,6,8-tetrol.
| Compound Name | (1R,3R,4R,5R,6R)-3-methoxy-7-phenyl-2-oxabicyclo[4.2.0]octane-4,5,6,8-tetrol |
|---|---|
| PubChem CID | 70150898 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (1R,3R,4R,5R,6R)-3-methoxy-7-phenyl-2-oxabicyclo[4.2.0]octane-4,5,6,8-tetrol |
| SMILES | CO[C@@H]1O[C@@H]2C(O)C(c3ccccc3)[C@@]2(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18O6/c1-19-13-10(16)11(17)14(18)8(9(15)12(14)20-13)7-5-3-2-4-6-7/h2-6,8-13,15-18H,1H3/t8?,9?,10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | QWWFJQKPEQGLRI-UXGMPZPXSA-N |
| XLogP | -1.03 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |