C10H20O6 — CID 70151145
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5,6-trimethoxy-2-methyloxan-3-ol (PubChem CID 70151145) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5,6-trimethoxy-2-methyloxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5,6-trimethoxy-2-methyloxan-3-ol |
|---|---|
| PubChem CID | 70151145 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5,6-trimethoxy-2-methyloxan-3-ol |
| SMILES | CO[C@H]1O[C@](C)(CO)C(O)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C10H20O6/c1-10(5-11)8(12)6(13-2)7(14-3)9(15-4)16-10/h6-9,11-12H,5H2,1-4H3/t6-,7-,8?,9+,10-/m1/s1 |
| InChIKey | IFBSIJQAMYECEU-SNIKVKKFSA-N |
| XLogP | -0.87 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |