About (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine
(3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine (PubChem CID 7015144) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine.
Analyze (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine?
The IUPAC name of (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine (CID 7015144) is (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine.
What is the SMILES notation for (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine?
The canonical SMILES for (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine is CC1(C)C[C@H](N)C(C)(C)N1O.
What is the InChIKey of (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine?
The InChIKey is USGBLEMQARVRDC-LURJTMIESA-N. The full InChI is InChI=1S/C8H18N2O/c1-7(2)5-6(9)8(3,4)10(7)11/h6,11H,5,9H2,1-4H3/t6-/m0/s1.
What are the key properties of (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine?
(3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine has a molecular weight of 158.24 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-amine is sourced from PubChem (CID 7015144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).