About 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine
6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine (PubChem CID 70151483) has the molecular formula C30H57N3
and a molecular weight of 459.81 g/mol. Its IUPAC name is 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine.
Molecular Properties
| Compound Name | 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine |
| PubChem CID | 70151483 |
| Molecular Formula | C30H57N3 |
| Molecular Weight | 459.81 g/mol |
| Exact Mass | 459.46 |
| IUPAC Name | 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine |
| SMILES | CC(N)CCCC(C)(C)c1cc(C(C)(C)CCCC(C)N)cc(C(C)(C)CCCC(C)N)c1 |
| InChI | InChI=1S/C30H57N3/c1-22(31)13-10-16-28(4,5)25-19-26(29(6,7)17-11-14-23(2)32)21-27(20-25)30(8,9)18-12-15-24(3)33/h19-24H,10-18,31-33H2,1-9H3 |
| InChIKey | PATRLTAGTRBJBF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.81 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine?
The IUPAC name of 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine (CID 70151483) is 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine.
What is the SMILES notation for 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine?
The canonical SMILES for 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine is CC(N)CCCC(C)(C)c1cc(C(C)(C)CCCC(C)N)cc(C(C)(C)CCCC(C)N)c1.
What is the InChIKey of 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine?
The InChIKey is PATRLTAGTRBJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H57N3/c1-22(31)13-10-16-28(4,5)25-19-26(29(6,7)17-11-14-23(2)32)21-27(20-25)30(8,9)18-12-15-24(3)33/h19-24H,10-18,31-33H2,1-9H3.
What are the key properties of 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine?
6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine has a molecular weight of 459.81 g/mol, XLogP of 7.07, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3,5-bis(6-amino-2-methylheptan-2-yl)phenyl]-6-methylheptan-2-amine is sourced from PubChem (CID 70151483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).