About (2R,4R)-hept-6-ene-2,4-diol
(2R,4R)-hept-6-ene-2,4-diol (PubChem CID 7015158) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is (2R,4R)-hept-6-ene-2,4-diol.
Molecular Properties
| Compound Name | (2R,4R)-hept-6-ene-2,4-diol |
| PubChem CID | 7015158 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (2R,4R)-hept-6-ene-2,4-diol |
| SMILES | C=CC[C@@H](O)C[C@@H](C)O |
| InChI | InChI=1S/C7H14O2/c1-3-4-7(9)5-6(2)8/h3,6-9H,1,4-5H2,2H3/t6-,7-/m1/s1 |
| InChIKey | IKSZUZSICAXOHV-RNFRBKRXSA-N |
| XLogP | 0.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-hept-6-ene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-hept-6-ene-2,4-diol?
The IUPAC name of (2R,4R)-hept-6-ene-2,4-diol (CID 7015158) is (2R,4R)-hept-6-ene-2,4-diol.
What is the SMILES notation for (2R,4R)-hept-6-ene-2,4-diol?
The canonical SMILES for (2R,4R)-hept-6-ene-2,4-diol is C=CC[C@@H](O)C[C@@H](C)O.
What is the InChIKey of (2R,4R)-hept-6-ene-2,4-diol?
The InChIKey is IKSZUZSICAXOHV-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-4-7(9)5-6(2)8/h3,6-9H,1,4-5H2,2H3/t6-,7-/m1/s1.
What are the key properties of (2R,4R)-hept-6-ene-2,4-diol?
(2R,4R)-hept-6-ene-2,4-diol has a molecular weight of 130.19 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-hept-6-ene-2,4-diol is sourced from PubChem (CID 7015158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).