C10H13N5O3S — CID 70152310
(2R,3S,4S,5S)-2-(6-amino-7H-purin-2-yl)-5-(hydroxymethyl)thiolane-3,4-diol (PubChem CID 70152310) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(6-amino-7H-purin-2-yl)-5-(hydroxymethyl)thiolane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-(6-amino-7H-purin-2-yl)-5-(hydroxymethyl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 70152310 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2R,3S,4S,5S)-2-(6-amino-7H-purin-2-yl)-5-(hydroxymethyl)thiolane-3,4-diol |
| SMILES | Nc1nc([C@H]2S[C@@H](CO)[C@@H](O)[C@@H]2O)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H13N5O3S/c11-8-4-9(13-2-12-4)15-10(14-8)7-6(18)5(17)3(1-16)19-7/h2-3,5-7,16-18H,1H2,(H3,11,12,13,14,15)/t3-,5+,6-,7-/m0/s1 |
| InChIKey | DVRBTFJJPDCGCB-CDGOZMSNSA-N |
| XLogP | -1.19 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |