C30H37N3O7 — CID 70152371
but-2-enedioic acid;1-[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]benzoyl]piperidin-2-one (PubChem CID 70152371) has the molecular formula C30H37N3O7 and a molecular weight of 551.64 g/mol. Its IUPAC name is but-2-enedioic acid;1-[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]benzoyl]piperidin-2-one.
| Compound Name | but-2-enedioic acid;1-[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]benzoyl]piperidin-2-one |
|---|---|
| PubChem CID | 70152371 |
| Molecular Formula | C30H37N3O7 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | but-2-enedioic acid;1-[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]benzoyl]piperidin-2-one |
| SMILES | CC(C)Oc1ccccc1N1CCN(Cc2cccc(C(=O)N3CCCCC3=O)c2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H33N3O3.C4H4O4/c1-20(2)32-24-11-4-3-10-23(24)28-16-14-27(15-17-28)19-21-8-7-9-22(18-21)26(31)29-13-6-5-12-25(29)30;5-3(6)1-2-4(7)8/h3-4,7-11,18,20H,5-6,12-17,19H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | IREOPBXNOIAGQV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|