About methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate
methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate (PubChem CID 70152463) has the molecular formula C27H33N3O2S
and a molecular weight of 463.65 g/mol. Its IUPAC name is methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate.
Molecular Properties
| Compound Name | methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate |
| PubChem CID | 70152463 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate |
| SMILES | CCc1ccc(N2CCN(c3cccc(-c4nccs4)c3)CC2)cc1CCCCC(=O)OC |
| InChI | InChI=1S/C27H33N3O2S/c1-3-21-11-12-25(19-22(21)7-4-5-10-26(31)32-2)30-16-14-29(15-17-30)24-9-6-8-23(20-24)27-28-13-18-33-27/h6,8-9,11-13,18-20H,3-5,7,10,14-17H2,1-2H3 |
| InChIKey | XNEVNZMKDQLFSG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate?
The IUPAC name of methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate (CID 70152463) is methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate.
What is the SMILES notation for methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate?
The canonical SMILES for methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate is CCc1ccc(N2CCN(c3cccc(-c4nccs4)c3)CC2)cc1CCCCC(=O)OC.
What is the InChIKey of methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate?
The InChIKey is XNEVNZMKDQLFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N3O2S/c1-3-21-11-12-25(19-22(21)7-4-5-10-26(31)32-2)30-16-14-29(15-17-30)24-9-6-8-23(20-24)27-28-13-18-33-27/h6,8-9,11-13,18-20H,3-5,7,10,14-17H2,1-2H3.
What are the key properties of methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate?
methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate has a molecular weight of 463.65 g/mol, XLogP of 5.58, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-ethyl-5-[4-[3-(1,3-thiazol-2-yl)phenyl]piperazin-1-yl]phenyl]pentanoate is sourced from PubChem (CID 70152463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).