About tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate
tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate (PubChem CID 70152627) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate |
| PubChem CID | 70152627 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO)C=COC1(C)C |
| InChI | InChI=1S/C12H21NO4/c1-11(2,3)17-10(15)13-9(8-14)6-7-16-12(13,4)5/h6-7,9,14H,8H2,1-5H3/t9-/m0/s1 |
| InChIKey | SPHRBZAZDBACCM-VIFPVBQESA-N |
| XLogP | 1.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate?
The IUPAC name of tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate (CID 70152627) is tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate.
What is the SMILES notation for tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate?
The canonical SMILES for tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate is CC(C)(C)OC(=O)N1[C@H](CO)C=COC1(C)C.
What is the InChIKey of tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate?
The InChIKey is SPHRBZAZDBACCM-VIFPVBQESA-N. The full InChI is InChI=1S/C12H21NO4/c1-11(2,3)17-10(15)13-9(8-14)6-7-16-12(13,4)5/h6-7,9,14H,8H2,1-5H3/t9-/m0/s1.
What are the key properties of tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate?
tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate has a molecular weight of 243.30 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-4H-1,3-oxazine-3-carboxylate is sourced from PubChem (CID 70152627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).